About 1,2-dihydroacenaphthylene
1,2-dihydroacenaphthylene (PubChem CID 6734) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | 1,2-dihydroacenaphthylene |
| PubChem CID | 6734 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 1,2-dihydroacenaphthylene |
| SMILES | c1cc2c3c(cccc3c1)CC2 |
| InChI | InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2 |
| InChIKey | CWRYPZZKDGJXCA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroacenaphthylene?
The IUPAC name of 1,2-dihydroacenaphthylene (CID 6734) is 1,2-dihydroacenaphthylene.
What is the SMILES notation for 1,2-dihydroacenaphthylene?
The canonical SMILES for 1,2-dihydroacenaphthylene is c1cc2c3c(cccc3c1)CC2.
What is the InChIKey of 1,2-dihydroacenaphthylene?
The InChIKey is CWRYPZZKDGJXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2.
What are the key properties of 1,2-dihydroacenaphthylene?
1,2-dihydroacenaphthylene has a molecular weight of 154.21 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroacenaphthylene is sourced from PubChem (CID 6734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).