C11H17NO6 — CID 67340276
7,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,6,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-4-one (PubChem CID 67340276) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is 7,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,6,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-4-one.
| Compound Name | 7,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,6,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-4-one |
|---|---|
| PubChem CID | 67340276 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 7,8-dihydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,6,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-4-one |
| SMILES | CC1(C)OC2C(=O)N3C(CO)C(O)C(O)C3C2O1 |
| InChI | InChI=1S/C11H17NO6/c1-11(2)17-8-5-7(15)6(14)4(3-13)12(5)10(16)9(8)18-11/h4-9,13-15H,3H2,1-2H3 |
| InChIKey | IRSPPIQIRFAYKM-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |