C22H26N2O3S — CID 67340543
(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methylsulfanyl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 67340543) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is (2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methylsulfanyl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | (2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methylsulfanyl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 67340543 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methylsulfanyl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | CCOc1cc2c(cc1OC)C(c1cccnc1SC)=N[C@@H]1CC[C@@H](O)C[C@H]21 |
| InChI | InChI=1S/C22H26N2O3S/c1-4-27-20-11-15-16-10-13(25)7-8-18(16)24-21(17(15)12-19(20)26-2)14-6-5-9-23-22(14)28-3/h5-6,9,11-13,16,18,25H,4,7-8,10H2,1-3H3/t13-,16-,18-/m1/s1 |
| InChIKey | KEMFWTDLRPBZIE-MZMPZRCHSA-N |
| XLogP | 4.06 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |