C7H13NO3 — CID 67340825
2,2-dimethyl-4,5-dihydro-3H-pyridine-3,4,5-triol (PubChem CID 67340825) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 2,2-dimethyl-4,5-dihydro-3H-pyridine-3,4,5-triol.
| Compound Name | 2,2-dimethyl-4,5-dihydro-3H-pyridine-3,4,5-triol |
|---|---|
| PubChem CID | 67340825 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2,2-dimethyl-4,5-dihydro-3H-pyridine-3,4,5-triol |
| SMILES | CC1(C)N=CC(O)C(O)C1O |
| InChI | InChI=1S/C7H13NO3/c1-7(2)6(11)5(10)4(9)3-8-7/h3-6,9-11H,1-2H3 |
| InChIKey | YHFXNPKUZWFBMK-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |