C9H16N2O3 — CID 67340868
2,2,4-trimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 67340868) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2,2,4-trimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | 2,2,4-trimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 67340868 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2,2,4-trimethyl-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CC1(C)OC2CNC(C)(C(N)=O)C2O1 |
| InChI | InChI=1S/C9H16N2O3/c1-8(2)13-5-4-11-9(3,7(10)12)6(5)14-8/h5-6,11H,4H2,1-3H3,(H2,10,12) |
| InChIKey | GKEDWDPEPPQSIX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |