C16H33NO2 — CID 67340954
(2R,3R,4S)-1-nonyl-2-propylpyrrolidine-3,4-diol (PubChem CID 67340954) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is (2R,3R,4S)-1-nonyl-2-propylpyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4S)-1-nonyl-2-propylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 67340954 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | (2R,3R,4S)-1-nonyl-2-propylpyrrolidine-3,4-diol |
| SMILES | CCCCCCCCCN1C[C@H](O)[C@H](O)[C@H]1CCC |
| InChI | InChI=1S/C16H33NO2/c1-3-5-6-7-8-9-10-12-17-13-15(18)16(19)14(17)11-4-2/h14-16,18-19H,3-13H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | QUQJTNQWBGKEEL-OWCLPIDISA-N |
| XLogP | 2.94 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|