About 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate
1-propylpiperidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 67341134) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate |
| PubChem CID | 67341134 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCC[NH+]1CCCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H17N.C2HF3O2/c1-2-6-9-7-4-3-5-8-9;3-2(4,5)1(6)7/h2-8H2,1H3;(H,6,7) |
| InChIKey | ACJCIMLTEIRDOV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate?
The IUPAC name of 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate (CID 67341134) is 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate?
The canonical SMILES for 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate is CCC[NH+]1CCCCC1.O=C([O-])C(F)(F)F.
What is the InChIKey of 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate?
The InChIKey is ACJCIMLTEIRDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2HF3O2/c1-2-6-9-7-4-3-5-8-9;3-2(4,5)1(6)7/h2-8H2,1H3;(H,6,7).
What are the key properties of 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate?
1-propylpiperidin-1-ium;2,2,2-trifluoroacetate has a molecular weight of 241.25 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylpiperidin-1-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 67341134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).