C8H13NO6 — CID 67341182
1,2,3,6,7-pentahydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 67341182) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is 1,2,3,6,7-pentahydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | 1,2,3,6,7-pentahydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 67341182 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1,2,3,6,7-pentahydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | O=C1C(O)C(O)CC2C(O)C(O)C(O)N12 |
| InChI | InChI=1S/C8H13NO6/c10-3-1-2-4(11)6(13)8(15)9(2)7(14)5(3)12/h2-6,8,10-13,15H,1H2 |
| InChIKey | NCKDTIJHOBCMQE-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |