About 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate
3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate (PubChem CID 6734135) has the molecular formula C22H21ClN2O2
and a molecular weight of 380.88 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate.
Molecular Properties
| Compound Name | 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate |
| PubChem CID | 6734135 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate |
| SMILES | O=C(NC(c1ccccc1)c1ccc(Cl)cc1)OCCCc1ccncc1 |
| InChI | InChI=1S/C22H21ClN2O2/c23-20-10-8-19(9-11-20)21(18-6-2-1-3-7-18)25-22(26)27-16-4-5-17-12-14-24-15-13-17/h1-3,6-15,21H,4-5,16H2,(H,25,26) |
| InChIKey | RCTIBPZQLDCTNY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate?
The IUPAC name of 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate (CID 6734135) is 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate.
What is the SMILES notation for 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate?
The canonical SMILES for 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate is O=C(NC(c1ccccc1)c1ccc(Cl)cc1)OCCCc1ccncc1.
What is the InChIKey of 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate?
The InChIKey is RCTIBPZQLDCTNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O2/c23-20-10-8-19(9-11-20)21(18-6-2-1-3-7-18)25-22(26)27-16-4-5-17-12-14-24-15-13-17/h1-3,6-15,21H,4-5,16H2,(H,25,26).
What are the key properties of 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate?
3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate has a molecular weight of 380.88 g/mol, XLogP of 5.18, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate is sourced from PubChem (CID 6734135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).