C22H21ClN2O2 — CID 6734135
3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate (PubChem CID 6734135) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate.
| Compound Name | 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 6734135 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-pyridin-4-ylpropyl N-[(4-chlorophenyl)-phenylmethyl]carbamate |
| SMILES | O=C(NC(c1ccccc1)c1ccc(Cl)cc1)OCCCc1ccncc1 |
| InChI | InChI=1S/C22H21ClN2O2/c23-20-10-8-19(9-11-20)21(18-6-2-1-3-7-18)25-22(26)27-16-4-5-17-12-14-24-15-13-17/h1-3,6-15,21H,4-5,16H2,(H,25,26) |
| InChIKey | RCTIBPZQLDCTNY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|