C17H17ClN2O6S — CID 6734153
3-[[2-(4-chloro-2-methylphenoxy)propanoylamino]carbamoyl]benzenesulfonic acid (PubChem CID 6734153) has the molecular formula C17H17ClN2O6S and a molecular weight of 412.85 g/mol. Its IUPAC name is 3-[[2-(4-chloro-2-methylphenoxy)propanoylamino]carbamoyl]benzenesulfonic acid.
| Compound Name | 3-[[2-(4-chloro-2-methylphenoxy)propanoylamino]carbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 6734153 |
| Molecular Formula | C17H17ClN2O6S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 3-[[2-(4-chloro-2-methylphenoxy)propanoylamino]carbamoyl]benzenesulfonic acid |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)NNC(=O)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H17ClN2O6S/c1-10-8-13(18)6-7-15(10)26-11(2)16(21)19-20-17(22)12-4-3-5-14(9-12)27(23,24)25/h3-9,11H,1-2H3,(H,19,21)(H,20,22)(H,23,24,25) |
| InChIKey | QZNDDDIDRJXDGD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|