About 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one
2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one (PubChem CID 67341804) has the molecular formula C17H21N3O
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one.
Molecular Properties
| Compound Name | 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one |
| PubChem CID | 67341804 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one |
| SMILES | NC12CC3CC(C1)CC(N1Cc4ccncc4C1=O)(C3)C2 |
| InChI | InChI=1S/C17H21N3O/c18-16-4-11-3-12(5-16)7-17(6-11,10-16)20-9-13-1-2-19-8-14(13)15(20)21/h1-2,8,11-12H,3-7,9-10,18H2 |
| InChIKey | YWXZGQUVOXRSNA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one?
The IUPAC name of 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one (CID 67341804) is 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one.
What is the SMILES notation for 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one?
The canonical SMILES for 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one is NC12CC3CC(C1)CC(N1Cc4ccncc4C1=O)(C3)C2.
What is the InChIKey of 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one?
The InChIKey is YWXZGQUVOXRSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O/c18-16-4-11-3-12(5-16)7-17(6-11,10-16)20-9-13-1-2-19-8-14(13)15(20)21/h1-2,8,11-12H,3-7,9-10,18H2.
What are the key properties of 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one?
2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one has a molecular weight of 283.37 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1-adamantyl)-1H-pyrrolo[3,4-c]pyridin-3-one is sourced from PubChem (CID 67341804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).