C25H21F3N4O3 — CID 67341812
3-[[3-[5-(2-ethoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-5-(3,4,5-trifluorophenyl)-1H-pyridazin-4-one (PubChem CID 67341812) has the molecular formula C25H21F3N4O3 and a molecular weight of 482.46 g/mol. Its IUPAC name is 3-[[3-[5-(2-ethoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-5-(3,4,5-trifluorophenyl)-1H-pyridazin-4-one.
| Compound Name | 3-[[3-[5-(2-ethoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-5-(3,4,5-trifluorophenyl)-1H-pyridazin-4-one |
|---|---|
| PubChem CID | 67341812 |
| Molecular Formula | C25H21F3N4O3 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 3-[[3-[5-(2-ethoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-5-(3,4,5-trifluorophenyl)-1H-pyridazin-4-one |
| SMILES | CCOCCOc1cnc(-c2cccc(Cc3n[nH]cc(-c4cc(F)c(F)c(F)c4)c3=O)c2)nc1 |
| InChI | InChI=1S/C25H21F3N4O3/c1-2-34-6-7-35-18-12-29-25(30-13-18)16-5-3-4-15(8-16)9-22-24(33)19(14-31-32-22)17-10-20(26)23(28)21(27)11-17/h3-5,8,10-14H,2,6-7,9H2,1H3,(H,31,33) |
| InChIKey | LYHQCYAREJNQDR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|