About 3H-pyrrolizine-1,2-diol
3H-pyrrolizine-1,2-diol (PubChem CID 67341931) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 3H-pyrrolizine-1,2-diol.
Molecular Properties
| Compound Name | 3H-pyrrolizine-1,2-diol |
| PubChem CID | 67341931 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 3H-pyrrolizine-1,2-diol |
| SMILES | OC1=C(O)c2cccn2C1 |
| InChI | InChI=1S/C7H7NO2/c9-6-4-8-3-1-2-5(8)7(6)10/h1-3,9-10H,4H2 |
| InChIKey | MAGWHCJOXCYUFT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-pyrrolizine-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrolizine-1,2-diol?
The IUPAC name of 3H-pyrrolizine-1,2-diol (CID 67341931) is 3H-pyrrolizine-1,2-diol.
What is the SMILES notation for 3H-pyrrolizine-1,2-diol?
The canonical SMILES for 3H-pyrrolizine-1,2-diol is OC1=C(O)c2cccn2C1.
What is the InChIKey of 3H-pyrrolizine-1,2-diol?
The InChIKey is MAGWHCJOXCYUFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-6-4-8-3-1-2-5(8)7(6)10/h1-3,9-10H,4H2.
What are the key properties of 3H-pyrrolizine-1,2-diol?
3H-pyrrolizine-1,2-diol has a molecular weight of 137.14 g/mol, XLogP of 1.29, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrolizine-1,2-diol is sourced from PubChem (CID 67341931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).