C10H17NO5 — CID 67341996
1,1,2-trihydroxy-6-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydroindolizin-5-one (PubChem CID 67341996) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1,1,2-trihydroxy-6-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | 1,1,2-trihydroxy-6-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 67341996 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1,1,2-trihydroxy-6-(2-hydroxyethyl)-2,3,6,7,8,8a-hexahydroindolizin-5-one |
| SMILES | O=C1C(CCO)CCC2N1CC(O)C2(O)O |
| InChI | InChI=1S/C10H17NO5/c12-4-3-6-1-2-7-10(15,16)8(13)5-11(7)9(6)14/h6-8,12-13,15-16H,1-5H2 |
| InChIKey | ZGHPZHHGEUCSKX-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|