About 3H-imidazo[1,2-b]pyrazole
3H-imidazo[1,2-b]pyrazole (PubChem CID 67342199) has the molecular formula C5H5N3
and a molecular weight of 107.12 g/mol. Its IUPAC name is 3H-imidazo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 3H-imidazo[1,2-b]pyrazole |
| PubChem CID | 67342199 |
| Molecular Formula | C5H5N3 |
| Molecular Weight | 107.12 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | 3H-imidazo[1,2-b]pyrazole |
| SMILES | C1=Nc2ccnn2C1 |
| InChI | InChI=1S/C5H5N3/c1-2-7-8-4-3-6-5(1)8/h1-3H,4H2 |
| InChIKey | AXYDUUKUHBRRCF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.12 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-imidazo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-imidazo[1,2-b]pyrazole?
The IUPAC name of 3H-imidazo[1,2-b]pyrazole (CID 67342199) is 3H-imidazo[1,2-b]pyrazole.
What is the SMILES notation for 3H-imidazo[1,2-b]pyrazole?
The canonical SMILES for 3H-imidazo[1,2-b]pyrazole is C1=Nc2ccnn2C1.
What is the InChIKey of 3H-imidazo[1,2-b]pyrazole?
The InChIKey is AXYDUUKUHBRRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3/c1-2-7-8-4-3-6-5(1)8/h1-3H,4H2.
What are the key properties of 3H-imidazo[1,2-b]pyrazole?
3H-imidazo[1,2-b]pyrazole has a molecular weight of 107.12 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-imidazo[1,2-b]pyrazole is sourced from PubChem (CID 67342199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).