C21H24N2O6 — CID 67342231
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-(2-phenylethyl)-1H-indazol-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 67342231) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-(2-phenylethyl)-1H-indazol-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-(2-phenylethyl)-1H-indazol-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67342231 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-(2-phenylethyl)-1H-indazol-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2n[nH]c3cccc(CCc4ccccc4)c23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24N2O6/c24-11-15-17(25)18(26)19(27)21(28-15)29-20-16-13(7-4-8-14(16)22-23-20)10-9-12-5-2-1-3-6-12/h1-8,15,17-19,21,24-27H,9-11H2,(H,22,23)/t15-,17-,18+,19-,21+/m1/s1 |
| InChIKey | BYFXJMLEXODECX-UVPIGPOJSA-N |
| XLogP | 0.53 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |