C18H23NO5 — CID 67342293
8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one (PubChem CID 67342293) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one.
| Compound Name | 8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
|---|---|
| PubChem CID | 67342293 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 8-hydroxy-2,2-dimethyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
| SMILES | CC1(C)OC2C(O1)C1C(O)CC(=O)N1C2COCc1ccccc1 |
| InChI | InChI=1S/C18H23NO5/c1-18(2)23-16-12(10-22-9-11-6-4-3-5-7-11)19-14(21)8-13(20)15(19)17(16)24-18/h3-7,12-13,15-17,20H,8-10H2,1-2H3 |
| InChIKey | FDGIUBJUMRYHPS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |