C9H11N5O3 — CID 67342660
2-oxo-N-(4-oxo-3,4a,5,8-tetrahydro-2H-pteridin-2-yl)propanamide (PubChem CID 67342660) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-oxo-N-(4-oxo-3,4a,5,8-tetrahydro-2H-pteridin-2-yl)propanamide.
| Compound Name | 2-oxo-N-(4-oxo-3,4a,5,8-tetrahydro-2H-pteridin-2-yl)propanamide |
|---|---|
| PubChem CID | 67342660 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-oxo-N-(4-oxo-3,4a,5,8-tetrahydro-2H-pteridin-2-yl)propanamide |
| SMILES | CC(=O)C(=O)NC1N=C2NC=CNC2C(=O)N1 |
| InChI | InChI=1S/C9H11N5O3/c1-4(15)7(16)13-9-12-6-5(8(17)14-9)10-2-3-11-6/h2-3,5,9-10H,1H3,(H,11,12)(H,13,16)(H,14,17) |
| InChIKey | QOKOZKNKLZTVHD-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|