C32H34N6O4S — CID 67343003
2-[7-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-morpholin-4-ylethanone (PubChem CID 67343003) has the molecular formula C32H34N6O4S and a molecular weight of 598.73 g/mol. Its IUPAC name is 2-[7-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[7-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 67343003 |
| Molecular Formula | C32H34N6O4S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 2-[7-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(Cc1nc2c(S(=O)(=O)c3ccccc3)nc3[nH]ccc3c2n1C1CCN(Cc2ccccc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C32H34N6O4S/c39-28(37-17-19-42-20-18-37)21-27-34-29-30(38(27)24-12-15-36(16-13-24)22-23-7-3-1-4-8-23)26-11-14-33-31(26)35-32(29)43(40,41)25-9-5-2-6-10-25/h1-11,14,24H,12-13,15-22H2,(H,33,35) |
| InChIKey | WZMUDKUNYVIZLE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |