C19H20N6O2S — CID 67343253
10-(benzenesulfonyl)-3-(4-methylpiperidin-4-yl)-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 67343253) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-3-(4-methylpiperidin-4-yl)-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 10-(benzenesulfonyl)-3-(4-methylpiperidin-4-yl)-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 67343253 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 10-(benzenesulfonyl)-3-(4-methylpiperidin-4-yl)-3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CC1(n2nnc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)CCNCC1 |
| InChI | InChI=1S/C19H20N6O2S/c1-19(8-10-20-11-9-19)25-17-15-7-12-24(18(15)21-13-16(17)22-23-25)28(26,27)14-5-3-2-4-6-14/h2-7,12-13,20H,8-11H2,1H3 |
| InChIKey | WZYNBEBKDXDZJC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |