C31H31N5O6S — CID 67343255
benzyl 4-[7-(benzenesulfonyl)-4-(2-ethoxy-2-oxoethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate (PubChem CID 67343255) has the molecular formula C31H31N5O6S and a molecular weight of 601.69 g/mol. Its IUPAC name is benzyl 4-[7-(benzenesulfonyl)-4-(2-ethoxy-2-oxoethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[7-(benzenesulfonyl)-4-(2-ethoxy-2-oxoethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67343255 |
| Molecular Formula | C31H31N5O6S |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | benzyl 4-[7-(benzenesulfonyl)-4-(2-ethoxy-2-oxoethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)Cc1nc2c(S(=O)(=O)c3ccccc3)nc3[nH]ccc3c2n1C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C31H31N5O6S/c1-2-41-26(37)19-25-33-27-28(24-13-16-32-29(24)34-30(27)43(39,40)23-11-7-4-8-12-23)36(25)22-14-17-35(18-15-22)31(38)42-20-21-9-5-3-6-10-21/h3-13,16,22H,2,14-15,17-20H2,1H3,(H,32,34) |
| InChIKey | DJCYADOEJPUXDS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |