C25H29N5O3S — CID 67343574
1-[4-[7-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidin-3-ol (PubChem CID 67343574) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 1-[4-[7-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidin-3-ol.
| Compound Name | 1-[4-[7-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 67343574 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 1-[4-[7-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]pyrrolidin-3-ol |
| SMILES | Cc1nc2c(S(=O)(=O)c3ccccc3)nc3[nH]ccc3c2n1C1CCC(N2CCC(O)C2)CC1 |
| InChI | InChI=1S/C25H29N5O3S/c1-16-27-22-23(30(16)18-9-7-17(8-10-18)29-14-12-19(31)15-29)21-11-13-26-24(21)28-25(22)34(32,33)20-5-3-2-4-6-20/h2-6,11,13,17-19,31H,7-10,12,14-15H2,1H3,(H,26,28) |
| InChIKey | QYWVKPMQJMEBRP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |