C26H24ClN5O — CID 67343692
N-(4-chlorophenyl)-2-methyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide (PubChem CID 67343692) has the molecular formula C26H24ClN5O and a molecular weight of 457.97 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-methyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-methyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 67343692 |
| Molecular Formula | C26H24ClN5O |
| Molecular Weight | 457.97 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-(4-chlorophenyl)-2-methyl-4-(4-phenylphthalazin-1-yl)piperazine-1-carboxamide |
| SMILES | CC1CN(c2nnc(-c3ccccc3)c3ccccc23)CCN1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClN5O/c1-18-17-31(15-16-32(18)26(33)28-21-13-11-20(27)12-14-21)25-23-10-6-5-9-22(23)24(29-30-25)19-7-3-2-4-8-19/h2-14,18H,15-17H2,1H3,(H,28,33) |
| InChIKey | WSMWCFDIFHWJSO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.97 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |