C21H24F3N7S — CID 67343730
N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-[4-(trifluoromethyl)cyclohexen-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 67343730) has the molecular formula C21H24F3N7S and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-[4-(trifluoromethyl)cyclohexen-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-[4-(trifluoromethyl)cyclohexen-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 67343730 |
| Molecular Formula | C21H24F3N7S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-8-[4-(trifluoromethyl)cyclohexen-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CCC(Nc3nc4c(C5=CCC(C(F)(F)F)CC5)cccn4n3)CC2)n1 |
| InChI | InChI=1S/C21H24F3N7S/c1-13-25-20(32-29-13)30-11-8-16(9-12-30)26-19-27-18-17(3-2-10-31(18)28-19)14-4-6-15(7-5-14)21(22,23)24/h2-4,10,15-16H,5-9,11-12H2,1H3,(H,26,28) |
| InChIKey | ZHQOEMOHYIDGNG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |