C25H28N6O4S — CID 67343894
N-[4-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]morpholine-4-carboxamide (PubChem CID 67343894) has the molecular formula C25H28N6O4S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[4-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]morpholine-4-carboxamide.
| Compound Name | N-[4-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 67343894 |
| Molecular Formula | C25H28N6O4S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-[4-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]morpholine-4-carboxamide |
| SMILES | O=C(NC1CCC(n2cnc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)CC1)N1CCOCC1 |
| InChI | InChI=1S/C25H28N6O4S/c32-25(29-12-14-35-15-13-29)28-18-6-8-19(9-7-18)30-17-27-22-16-26-24-21(23(22)30)10-11-31(24)36(33,34)20-4-2-1-3-5-20/h1-5,10-11,16-19H,6-9,12-15H2,(H,28,32) |
| InChIKey | ZSWGIOHQBKBWIF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |