C23H28FN5O4S — CID 67344065
tert-butyl (3S,4S)-4-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]-3-fluoropiperidine-1-carboxylate (PubChem CID 67344065) has the molecular formula C23H28FN5O4S and a molecular weight of 489.57 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67344065 |
| Molecular Formula | C23H28FN5O4S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | tert-butyl (3S,4S)-4-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](N(c2ccnc3[nH]ccc23)S(=O)(=O)c2cccc(N)c2)[C@@H](F)C1 |
| InChI | InChI=1S/C23H28FN5O4S/c1-23(2,3)33-22(30)28-12-9-20(18(24)14-28)29(19-8-11-27-21-17(19)7-10-26-21)34(31,32)16-6-4-5-15(25)13-16/h4-8,10-11,13,18,20H,9,12,14,25H2,1-3H3,(H,26,27)/t18-,20-/m0/s1 |
| InChIKey | FHGGBISIQVCTHB-ICSRJNTNSA-N |
| XLogP | 3.69 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|