About methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate
methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate (PubChem CID 67344116) has the molecular formula C21H24N4O4S
and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 67344116 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(N(c2c(N)cnc3[nH]ccc23)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N4O4S/c1-29-21(26)14-7-9-15(10-8-14)25(30(27,28)16-5-3-2-4-6-16)19-17-11-12-23-20(17)24-13-18(19)22/h2-6,11-15H,7-10,22H2,1H3,(H,23,24) |
| InChIKey | ZSNUDYRZMMLWNC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
The IUPAC name of methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate (CID 67344116) is methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate is COC(=O)C1CCC(N(c2c(N)cnc3[nH]ccc23)S(=O)(=O)c2ccccc2)CC1.
What is the InChIKey of methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
The InChIKey is ZSNUDYRZMMLWNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O4S/c1-29-21(26)14-7-9-15(10-8-14)25(30(27,28)16-5-3-2-4-6-16)19-17-11-12-23-20(17)24-13-18(19)22/h2-6,11-15H,7-10,22H2,1H3,(H,23,24).
What are the key properties of methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate has a molecular weight of 428.51 g/mol, XLogP of 3.07, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 67344116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).