C29H29N5O4S — CID 67344174
ethyl 10-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxylate (PubChem CID 67344174) has the molecular formula C29H29N5O4S and a molecular weight of 543.65 g/mol. Its IUPAC name is ethyl 10-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxylate.
| Compound Name | ethyl 10-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 67344174 |
| Molecular Formula | C29H29N5O4S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | ethyl 10-(benzenesulfonyl)-3-(1-benzylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H29N5O4S/c1-2-38-29(35)28-31-25-19-30-27-24(15-18-33(27)39(36,37)23-11-7-4-8-12-23)26(25)34(28)22-13-16-32(17-14-22)20-21-9-5-3-6-10-21/h3-12,15,18-19,22H,2,13-14,16-17,20H2,1H3 |
| InChIKey | GMIKZKKKVMUGHT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |