C19H24FN5O2 — CID 67344314
tert-butyl 3-fluoro-4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidine-1-carboxylate (PubChem CID 67344314) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67344314 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | tert-butyl 3-fluoro-4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidine-1-carboxylate |
| SMILES | Cc1nc2cnc3[nH]ccc3c2n1C1CCN(C(=O)OC(C)(C)C)CC1F |
| InChI | InChI=1S/C19H24FN5O2/c1-11-23-14-9-22-17-12(5-7-21-17)16(14)25(11)15-6-8-24(10-13(15)20)18(26)27-19(2,3)4/h5,7,9,13,15H,6,8,10H2,1-4H3,(H,21,22) |
| InChIKey | GGNGBWVBNYZTKW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |