C25H40BNO4 — CID 67344477
cyclopentyl (2R)-4-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylamino]pentanoate (PubChem CID 67344477) has the molecular formula C25H40BNO4 and a molecular weight of 429.41 g/mol. Its IUPAC name is cyclopentyl (2R)-4-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylamino]pentanoate.
| Compound Name | cyclopentyl (2R)-4-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylamino]pentanoate |
|---|---|
| PubChem CID | 67344477 |
| Molecular Formula | C25H40BNO4 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | cyclopentyl (2R)-4-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylamino]pentanoate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CN[C@H](CC(C)C)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C25H40BNO4/c1-17(2)14-22(23(28)29-21-10-8-9-11-21)27-16-19-12-13-20(15-18(19)3)26-30-24(4,5)25(6,7)31-26/h12-13,15,17,21-22,27H,8-11,14,16H2,1-7H3/t22-/m1/s1 |
| InChIKey | QLLPTXGXHVDQQG-JOCHJYFZSA-N |
| XLogP | 4.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|