C24H30N2O5 — CID 6734497
2-(2,4,6-trimethylphenyl)ethyl N-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]carbamate (PubChem CID 6734497) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)ethyl N-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]carbamate.
| Compound Name | 2-(2,4,6-trimethylphenyl)ethyl N-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 6734497 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)ethyl N-[[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetyl]amino]carbamate |
| SMILES | Cc1cc(C)c(CCOC(=O)NNC(=O)COc2cccc3c2OC(C)(C)C3)c(C)c1 |
| InChI | InChI=1S/C24H30N2O5/c1-15-11-16(2)19(17(3)12-15)9-10-29-23(28)26-25-21(27)14-30-20-8-6-7-18-13-24(4,5)31-22(18)20/h6-8,11-12H,9-10,13-14H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | HQHKFWOVMDIRIB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|