About 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride
5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride (PubChem CID 67345140) has the molecular formula C10H14ClN3OS
and a molecular weight of 259.76 g/mol. Its IUPAC name is 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride.
Molecular Properties
| Compound Name | 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride |
| PubChem CID | 67345140 |
| Molecular Formula | C10H14ClN3OS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride |
| SMILES | Cl.NCCCNc1cc(=O)c2sccc2[nH]1 |
| InChI | InChI=1S/C10H13N3OS.ClH/c11-3-1-4-12-9-6-8(14)10-7(13-9)2-5-15-10;/h2,5-6H,1,3-4,11H2,(H2,12,13,14);1H |
| InChIKey | OFOMGGMKXLKLBS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride?
The IUPAC name of 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride (CID 67345140) is 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride.
What is the SMILES notation for 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride?
The canonical SMILES for 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride is Cl.NCCCNc1cc(=O)c2sccc2[nH]1.
What is the InChIKey of 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride?
The InChIKey is OFOMGGMKXLKLBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS.ClH/c11-3-1-4-12-9-6-8(14)10-7(13-9)2-5-15-10;/h2,5-6H,1,3-4,11H2,(H2,12,13,14);1H.
What are the key properties of 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride?
5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride has a molecular weight of 259.76 g/mol, XLogP of 1.77, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminopropylamino)-4H-thieno[3,2-b]pyridin-7-one;hydrochloride is sourced from PubChem (CID 67345140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).