C22H23F3N4O6 — CID 67345489
pyrrolidin-3-yl-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 67345489) has the molecular formula C22H23F3N4O6 and a molecular weight of 496.44 g/mol. Its IUPAC name is pyrrolidin-3-yl-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | pyrrolidin-3-yl-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67345489 |
| Molecular Formula | C22H23F3N4O6 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | pyrrolidin-3-yl-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(-c2cnc3[nH]cc(C(=O)C4CCNC4)c3n2)cc(OC)c1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22N4O4.C2HF3O2/c1-26-15-6-12(7-16(27-2)19(15)28-3)14-10-23-20-17(24-14)13(9-22-20)18(25)11-4-5-21-8-11;3-2(4,5)1(6)7/h6-7,9-11,21H,4-5,8H2,1-3H3,(H,22,23);(H,6,7) |
| InChIKey | DPVHQQZSBRPZSU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |