About [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid
[(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid (PubChem CID 67345862) has the molecular formula C17H28N4O3
and a molecular weight of 336.44 g/mol. Its IUPAC name is [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid.
Molecular Properties
| Compound Name | [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid |
| PubChem CID | 67345862 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid |
| SMILES | CCO[C@@H]1C[C@H](N(C(=O)O)C(C)(C)C)CN(c2ccncc2N)C1 |
| InChI | InChI=1S/C17H28N4O3/c1-5-24-13-8-12(21(16(22)23)17(2,3)4)10-20(11-13)15-6-7-19-9-14(15)18/h6-7,9,12-13H,5,8,10-11,18H2,1-4H3,(H,22,23)/t12-,13+/m0/s1 |
| InChIKey | QCHXFKOOUSGXJC-QWHCGFSZSA-N |
| XLogP | 2.43 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid?
The IUPAC name of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid (CID 67345862) is [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid.
What is the SMILES notation for [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid?
The canonical SMILES for [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid is CCO[C@@H]1C[C@H](N(C(=O)O)C(C)(C)C)CN(c2ccncc2N)C1.
What is the InChIKey of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid?
The InChIKey is QCHXFKOOUSGXJC-QWHCGFSZSA-N. The full InChI is InChI=1S/C17H28N4O3/c1-5-24-13-8-12(21(16(22)23)17(2,3)4)10-20(11-13)15-6-7-19-9-14(15)18/h6-7,9,12-13H,5,8,10-11,18H2,1-4H3,(H,22,23)/t12-,13+/m0/s1.
What are the key properties of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid?
[(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid has a molecular weight of 336.44 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5R)-1-(3-amino-4-pyridinyl)-5-ethoxypiperidin-3-yl]-tert-butylcarbamic acid is sourced from PubChem (CID 67345862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).