C18H22F3N5O — CID 67345882
(1R)-1-[3-[4-(2,2,2-trifluoroethylamino)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 67345882) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is (1R)-1-[3-[4-(2,2,2-trifluoroethylamino)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[3-[4-(2,2,2-trifluoroethylamino)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 67345882 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (1R)-1-[3-[4-(2,2,2-trifluoroethylamino)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1C1CCC(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H22F3N5O/c1-10(27)17-25-14-8-23-16-13(6-7-22-16)15(14)26(17)12-4-2-11(3-5-12)24-9-18(19,20)21/h6-8,10-12,24,27H,2-5,9H2,1H3,(H,22,23)/t10-,11?,12?/m1/s1 |
| InChIKey | HIXYDBSLZYKHEU-VOMCLLRMSA-N |
| XLogP | 3.60 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |