About ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate
ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate (PubChem CID 67346060) has the molecular formula C22H26N4O4S
and a molecular weight of 442.54 g/mol. Its IUPAC name is ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 67346060 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(N(c2c(N)cnc3[nH]ccc23)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N4O4S/c1-2-30-22(27)15-8-10-16(11-9-15)26(31(28,29)17-6-4-3-5-7-17)20-18-12-13-24-21(18)25-14-19(20)23/h3-7,12-16H,2,8-11,23H2,1H3,(H,24,25) |
| InChIKey | YYBVUCQBBVCOSC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate (CID 67346060) is ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate is CCOC(=O)C1CCC(N(c2c(N)cnc3[nH]ccc23)S(=O)(=O)c2ccccc2)CC1.
What is the InChIKey of ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
The InChIKey is YYBVUCQBBVCOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O4S/c1-2-30-22(27)15-8-10-16(11-9-15)26(31(28,29)17-6-4-3-5-7-17)20-18-12-13-24-21(18)25-14-19(20)23/h3-7,12-16H,2,8-11,23H2,1H3,(H,24,25).
What are the key properties of ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate?
ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate has a molecular weight of 442.54 g/mol, XLogP of 3.46, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(5-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-(benzenesulfonyl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 67346060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).