C21H30FN3OS — CID 67346168
2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 67346168) has the molecular formula C21H30FN3OS and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67346168 |
| Molecular Formula | C21H30FN3OS |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | CCCCN1/C(=N/C2CCCCC2)SCC1CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H30FN3OS/c1-2-3-13-25-19(14-20(26)23-18-11-9-16(22)10-12-18)15-27-21(25)24-17-7-5-4-6-8-17/h9-12,17,19H,2-8,13-15H2,1H3,(H,23,26)/b24-21- |
| InChIKey | MHVIHKQQSYPPGP-FLFQWRMESA-N |
| XLogP | 5.06 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|