C20H28FN3OS — CID 67346260
2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide (PubChem CID 67346260) has the molecular formula C20H28FN3OS and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 67346260 |
| Molecular Formula | C20H28FN3OS |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2CS/C(=N\C3CCCCCC3)N2C)c(F)c1 |
| InChI | InChI=1S/C20H28FN3OS/c1-14-9-10-18(17(21)11-14)23-19(25)12-16-13-26-20(24(16)2)22-15-7-5-3-4-6-8-15/h9-11,15-16H,3-8,12-13H2,1-2H3,(H,23,25)/b22-20- |
| InChIKey | XSLFUVBAWBEWHM-XDOYNYLZSA-N |
| XLogP | 4.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|