C22H19ClF3N5O3S — CID 67346551
5-[[1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]indazol-5-yl]methylidene]-2-[2,3-dihydroxypropyl(methyl)amino]-1,3-thiazol-4-one (PubChem CID 67346551) has the molecular formula C22H19ClF3N5O3S and a molecular weight of 525.94 g/mol. Its IUPAC name is 5-[[1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]indazol-5-yl]methylidene]-2-[2,3-dihydroxypropyl(methyl)amino]-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]indazol-5-yl]methylidene]-2-[2,3-dihydroxypropyl(methyl)amino]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67346551 |
| Molecular Formula | C22H19ClF3N5O3S |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 5-[[1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]indazol-5-yl]methylidene]-2-[2,3-dihydroxypropyl(methyl)amino]-1,3-thiazol-4-one |
| SMILES | CN(CC(O)CO)C1=NC(=O)C(=Cc2ccc3c(cnn3Cc3ncc(C(F)(F)F)cc3Cl)c2)S1 |
| InChI | InChI=1S/C22H19ClF3N5O3S/c1-30(9-15(33)11-32)21-29-20(34)19(35-21)5-12-2-3-18-13(4-12)7-28-31(18)10-17-16(23)6-14(8-27-17)22(24,25)26/h2-8,15,32-33H,9-11H2,1H3 |
| InChIKey | BQVCORRVSYPJDP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|