C21H23ClFN3OS — CID 67346952
N-(4-chloro-2-fluorophenyl)-2-[3-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]acetamide (PubChem CID 67346952) has the molecular formula C21H23ClFN3OS and a molecular weight of 419.95 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[3-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[3-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 67346952 |
| Molecular Formula | C21H23ClFN3OS |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[3-methyl-2-(4-propan-2-ylphenyl)imino-1,3-thiazolidin-4-yl]acetamide |
| SMILES | CC(C)c1ccc(/N=C2\SCC(CC(=O)Nc3ccc(Cl)cc3F)N2C)cc1 |
| InChI | InChI=1S/C21H23ClFN3OS/c1-13(2)14-4-7-16(8-5-14)24-21-26(3)17(12-28-21)11-20(27)25-19-9-6-15(22)10-18(19)23/h4-10,13,17H,11-12H2,1-3H3,(H,25,27)/b24-21- |
| InChIKey | RZKZHRRWPYOUOD-FLFQWRMESA-N |
| XLogP | 5.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|