About 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one
8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one (PubChem CID 673470) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one.
Molecular Properties
| Compound Name | 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one |
| PubChem CID | 673470 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one |
| SMILES | COc1cc(=O)n(C)c2c(OC[C@@H](O)C(C)(C)O)cccc12 |
| InChI | InChI=1S/C16H21NO5/c1-16(2,20)13(18)9-22-11-7-5-6-10-12(21-4)8-14(19)17(3)15(10)11/h5-8,13,18,20H,9H2,1-4H3/t13-/m1/s1 |
| InChIKey | IUPYLWAXGAJZQC-CYBMUJFWSA-N |
| XLogP | 1.06 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one?
The IUPAC name of 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one (CID 673470) is 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one.
What is the SMILES notation for 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one?
The canonical SMILES for 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one is COc1cc(=O)n(C)c2c(OC[C@@H](O)C(C)(C)O)cccc12.
What is the InChIKey of 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one?
The InChIKey is IUPYLWAXGAJZQC-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H21NO5/c1-16(2,20)13(18)9-22-11-7-5-6-10-12(21-4)8-14(19)17(3)15(10)11/h5-8,13,18,20H,9H2,1-4H3/t13-/m1/s1.
What are the key properties of 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one?
8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one has a molecular weight of 307.35 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-methoxy-1-methylquinolin-2-one is sourced from PubChem (CID 673470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).