About [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid
[(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid (PubChem CID 67347099) has the molecular formula C12H18N4O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid |
| PubChem CID | 67347099 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid |
| SMILES | CO[C@@H]1C[C@H](NC(=O)O)CN(c2ccncc2N)C1 |
| InChI | InChI=1S/C12H18N4O3/c1-19-9-4-8(15-12(17)18)6-16(7-9)11-2-3-14-5-10(11)13/h2-3,5,8-9,15H,4,6-7,13H2,1H3,(H,17,18)/t8-,9+/m0/s1 |
| InChIKey | QDHIKFYNYXTHIH-DTWKUNHWSA-N |
| XLogP | 0.53 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid?
The IUPAC name of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid (CID 67347099) is [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid.
What is the SMILES notation for [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid?
The canonical SMILES for [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid is CO[C@@H]1C[C@H](NC(=O)O)CN(c2ccncc2N)C1.
What is the InChIKey of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid?
The InChIKey is QDHIKFYNYXTHIH-DTWKUNHWSA-N. The full InChI is InChI=1S/C12H18N4O3/c1-19-9-4-8(15-12(17)18)6-16(7-9)11-2-3-14-5-10(11)13/h2-3,5,8-9,15H,4,6-7,13H2,1H3,(H,17,18)/t8-,9+/m0/s1.
What are the key properties of [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid?
[(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid has a molecular weight of 266.30 g/mol, XLogP of 0.53, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5R)-1-(3-amino-4-pyridinyl)-5-methoxypiperidin-3-yl]carbamic acid is sourced from PubChem (CID 67347099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).