About 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine
6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine (PubChem CID 67347348) has the molecular formula C25H27N3O
and a molecular weight of 385.51 g/mol. Its IUPAC name is 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine.
Molecular Properties
| Compound Name | 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine |
| PubChem CID | 67347348 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine |
| SMILES | CC(C)(C)C#Cc1ccccc1-c1ccc2nc(N)c(N3CCOCC3)cc2c1 |
| InChI | InChI=1S/C25H27N3O/c1-25(2,3)11-10-18-6-4-5-7-21(18)19-8-9-22-20(16-19)17-23(24(26)27-22)28-12-14-29-15-13-28/h4-9,16-17H,12-15H2,1-3H3,(H2,26,27) |
| InChIKey | ODIAFITZPGNUHW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine?
The IUPAC name of 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine (CID 67347348) is 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine.
What is the SMILES notation for 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine?
The canonical SMILES for 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine is CC(C)(C)C#Cc1ccccc1-c1ccc2nc(N)c(N3CCOCC3)cc2c1.
What is the InChIKey of 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine?
The InChIKey is ODIAFITZPGNUHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O/c1-25(2,3)11-10-18-6-4-5-7-21(18)19-8-9-22-20(16-19)17-23(24(26)27-22)28-12-14-29-15-13-28/h4-9,16-17H,12-15H2,1-3H3,(H2,26,27).
What are the key properties of 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine?
6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine has a molecular weight of 385.51 g/mol, XLogP of 4.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,3-dimethylbut-1-ynyl)phenyl]-3-morpholin-4-ylquinolin-2-amine is sourced from PubChem (CID 67347348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).