C24H26N6O4S2 — CID 67347852
2-[7-(benzenesulfonyl)-3-(1-propylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetonitrile (PubChem CID 67347852) has the molecular formula C24H26N6O4S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is 2-[7-(benzenesulfonyl)-3-(1-propylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetonitrile.
| Compound Name | 2-[7-(benzenesulfonyl)-3-(1-propylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetonitrile |
|---|---|
| PubChem CID | 67347852 |
| Molecular Formula | C24H26N6O4S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 2-[7-(benzenesulfonyl)-3-(1-propylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetonitrile |
| SMILES | CCCS(=O)(=O)N1CCC(n2c(CC#N)nc3c(S(=O)(=O)c4ccccc4)nc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C24H26N6O4S2/c1-2-16-35(31,32)29-14-10-17(11-15-29)30-20(8-12-25)27-21-22(30)19-9-13-26-23(19)28-24(21)36(33,34)18-6-4-3-5-7-18/h3-7,9,13,17H,2,8,10-11,14-16H2,1H3,(H,26,28) |
| InChIKey | HUXLLNZMHHNFAF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |