About N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide
N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide (PubChem CID 67348398) has the molecular formula C20H27Cl2N3OS
and a molecular weight of 428.43 g/mol. Its IUPAC name is N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide.
Molecular Properties
| Compound Name | N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide |
| PubChem CID | 67348398 |
| Molecular Formula | C20H27Cl2N3OS |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide |
| SMILES | CCCN1/C(=N/C2CCCCC2)SCC1N(C(C)=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H27Cl2N3OS/c1-3-9-24-19(13-27-20(24)23-17-7-5-4-6-8-17)25(14(2)26)18-11-15(21)10-16(22)12-18/h10-12,17,19H,3-9,13H2,1-2H3/b23-20- |
| InChIKey | LUPOZHZYNOYVAD-ATJXCDBQSA-N |
| XLogP | 5.82 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide?
The IUPAC name of N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide (CID 67348398) is N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide.
What is the SMILES notation for N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide?
The canonical SMILES for N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide is CCCN1/C(=N/C2CCCCC2)SCC1N(C(C)=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide?
The InChIKey is LUPOZHZYNOYVAD-ATJXCDBQSA-N. The full InChI is InChI=1S/C20H27Cl2N3OS/c1-3-9-24-19(13-27-20(24)23-17-7-5-4-6-8-17)25(14(2)26)18-11-15(21)10-16(22)12-18/h10-12,17,19H,3-9,13H2,1-2H3/b23-20-.
What are the key properties of N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide?
N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide has a molecular weight of 428.43 g/mol, XLogP of 5.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclohexylimino-3-propyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide is sourced from PubChem (CID 67348398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).