C21H29N7OS — CID 67348788
(6S)-13-(ethylamino)-8-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 67348788) has the molecular formula C21H29N7OS and a molecular weight of 427.58 g/mol. Its IUPAC name is (6S)-13-(ethylamino)-8-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-13-(ethylamino)-8-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 67348788 |
| Molecular Formula | C21H29N7OS |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (6S)-13-(ethylamino)-8-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(CC1CCN(c3nccs3)CC1)C2=O |
| InChI | InChI=1S/C21H29N7OS/c1-2-22-20-24-12-17-18(25-20)28-8-3-4-16(28)14-27(19(17)29)13-15-5-9-26(10-6-15)21-23-7-11-30-21/h7,11-12,15-16H,2-6,8-10,13-14H2,1H3,(H,22,24,25)/t16-/m0/s1 |
| InChIKey | VNTUSXSVYWOQGE-INIZCTEOSA-N |
| XLogP | 2.71 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |