C21H22N8O3 — CID 67348848
3-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 67348848) has the molecular formula C21H22N8O3 and a molecular weight of 434.46 g/mol. Its IUPAC name is 3-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 67348848 |
| Molecular Formula | C21H22N8O3 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 3-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc(-c3noc(C(N)=O)n3)c1)C2=O |
| InChI | InChI=1S/C21H22N8O3/c1-2-23-21-24-10-15-18(26-21)28-8-4-7-14(28)11-29(20(15)31)13-6-3-5-12(9-13)17-25-19(16(22)30)32-27-17/h3,5-6,9-10,14H,2,4,7-8,11H2,1H3,(H2,22,30)(H,23,24,26)/t14-/m0/s1 |
| InChIKey | MJGDBUIWNRKVJT-AWEZNQCLSA-N |
| XLogP | 1.69 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |