C17H25N5O — CID 67348937
(6S)-8-(cyclopentylmethyl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 67348937) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is (6S)-8-(cyclopentylmethyl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-8-(cyclopentylmethyl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 67348937 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (6S)-8-(cyclopentylmethyl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CNc1ncc2c(n1)N1CCC[C@H]1CN(CC1CCCC1)C2=O |
| InChI | InChI=1S/C17H25N5O/c1-18-17-19-9-14-15(20-17)22-8-4-7-13(22)11-21(16(14)23)10-12-5-2-3-6-12/h9,12-13H,2-8,10-11H2,1H3,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | SCBUSFJFJBOBSO-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |