C26H34F3N3OS — CID 67349158
2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 67349158) has the molecular formula C26H34F3N3OS and a molecular weight of 493.64 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67349158 |
| Molecular Formula | C26H34F3N3OS |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCN1/C(=N/C23CC4CC(CC(C4)C2)C3)SCC1CC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H34F3N3OS/c1-2-3-8-32-22(12-23(33)30-21-6-4-20(5-7-21)26(27,28)29)16-34-24(32)31-25-13-17-9-18(14-25)11-19(10-17)15-25/h4-7,17-19,22H,2-3,8-16H2,1H3,(H,30,33)/b31-24- |
| InChIKey | ZKTDFDZHWYBTST-QLTSDVKISA-N |
| XLogP | 6.58 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|