About 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline
2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline (PubChem CID 67349175) has the molecular formula C13H13F2N3O2
and a molecular weight of 281.26 g/mol. Its IUPAC name is 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline.
Molecular Properties
| Compound Name | 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline |
| PubChem CID | 67349175 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline |
| SMILES | COc1cc(OC)nc(Cc2c(F)ccc(F)c2N)n1 |
| InChI | InChI=1S/C13H13F2N3O2/c1-19-11-6-12(20-2)18-10(17-11)5-7-8(14)3-4-9(15)13(7)16/h3-4,6H,5,16H2,1-2H3 |
| InChIKey | BLHBWBVVYFVKBA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline?
The IUPAC name of 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline (CID 67349175) is 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline.
What is the SMILES notation for 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline?
The canonical SMILES for 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline is COc1cc(OC)nc(Cc2c(F)ccc(F)c2N)n1.
What is the InChIKey of 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline?
The InChIKey is BLHBWBVVYFVKBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3O2/c1-19-11-6-12(20-2)18-10(17-11)5-7-8(14)3-4-9(15)13(7)16/h3-4,6H,5,16H2,1-2H3.
What are the key properties of 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline?
2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline has a molecular weight of 281.26 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethoxypyrimidin-2-yl)methyl]-3,6-difluoroaniline is sourced from PubChem (CID 67349175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).